6-(2-Phenoxyethoxy-6-deaminomitomycin C)
Modify Date: 2025-08-25 12:34:43
6-(2-Phenoxyethoxy-6-deaminomitomycin C) structure
|
Common Name | 6-(2-Phenoxyethoxy-6-deaminomitomycin C) | ||
|---|---|---|---|---|
| CAS Number | 118598-87-1 | Molecular Weight | 455.46100 | |
| Density | 1.45g/cm3 | Boiling Point | 691ºC at 760mmHg | |
| Molecular Formula | C23H25N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.7ºC | |
| Name | 6-(2-Phenoxyethoxy-6-deaminomitomycin C) |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 691ºC at 760mmHg |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.46100 |
| Flash Point | 371.7ºC |
| Exact Mass | 455.16900 |
| PSA | 140.32000 |
| LogP | 1.26620 |
| Vapour Pressure | 6.08E-19mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | VMSOEFWICPVQKF-USYHLRJESA-N |
| SMILES | COC12C(COC(N)=O)C3=C(C(=O)C(C)=C(OCCOc4ccccc4)C3=O)N1CC1NC12 |
|
~68%
6-(2-Phenoxyeth... CAS#:118598-87-1 |
| Literature: Sami; Remers; Bradner Journal of Medicinal Chemistry, 1989 , vol. 32, # 3 p. 703 - 708 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |