Schisanwilsonin B
Modify Date: 2025-08-25 11:28:17
Schisanwilsonin B structure
|
Common Name | Schisanwilsonin B | ||
|---|---|---|---|---|
| CAS Number | 1181216-84-1 | Molecular Weight | 514.56 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 638.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C28H34O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.5±25.0 °C | |
Use of Schisanwilsonin BSchisanwilsonin B is a lignan from the fruits of Schisandra wilsoniana[1]. |
| Name | Arisanschinin L |
|---|---|
| Synonym | More Synonyms |
| Description | Schisanwilsonin B is a lignan from the fruits of Schisandra wilsoniana[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 638.6±55.0 °C at 760 mmHg |
| Molecular Formula | C28H34O9 |
| Molecular Weight | 514.56 |
| Flash Point | 206.5±25.0 °C |
| Exact Mass | 514.220276 |
| PSA | 101.91000 |
| LogP | 6.06 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | BKGUPIVDQHHVMV-OUJBPAAASA-N |
| SMILES | CC=C(C)C(=O)OC1c2cc(OC)c(OC)c(OC)c2-c2c(cc3c(c2OC)OCO3)CC(C)C1(C)O |
| Hazard Codes | Xi |
|---|
| 2-Butenoic acid, 2-methyl-, (5S,6R,7S)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl ester, (2E)- |
| Tigloylgomisin P |
| (5S,6R,7S)-6-Hydroxy-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2E)-2-methyl-2-butenoate |
| Schisanwilsonin I |
| Schisanwilsonin B |