diethyl (1-methylbutyl)malonate structure
|
Common Name | diethyl (1-methylbutyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 117-47-5 | Molecular Weight | 230.30100 | |
| Density | 0,97 g/cm3 | Boiling Point | 118-119°C 9mm | |
| Molecular Formula | C12H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118-119°C/9mm | |
| Name | diethyl 2-pentan-2-ylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0,97 g/cm3 |
|---|---|
| Boiling Point | 118-119°C 9mm |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30100 |
| Flash Point | 118-119°C/9mm |
| Exact Mass | 230.15200 |
| PSA | 52.60000 |
| LogP | 2.16500 |
| Vapour Pressure | 0.0192mmHg at 25°C |
| Index of Refraction | 1.4270 |
| InChIKey | RQFSNEWORATSCC-UHFFFAOYSA-N |
| SMILES | CCCC(C)C(C(=O)OCC)C(=O)OCC |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2917190090 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Methylbutyl malonic ester |
| Diethyl 1-Methylbutylmalonate |
| 1-Methylbutylmalonic Acid Diethyl Ester |
| diethyl pent-2-enylmalonate |
| EINECS 204-193-4 |
| diethyl pentan-2-ylmalonate |
| MFCD00051558 |