diethyl (1-methylbutyl)vinylmalonate
Modify Date: 2025-09-24 22:29:55
diethyl (1-methylbutyl)vinylmalonate structure
|
Common Name | diethyl (1-methylbutyl)vinylmalonate | ||
|---|---|---|---|---|
| CAS Number | 84100-22-1 | Molecular Weight | 256.33800 | |
| Density | 0.977g/cm3 | Boiling Point | 309.3ºC at 760 mmHg | |
| Molecular Formula | C14H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141ºC | |
| Name | diethyl 2-(3-methylhex-1-enyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.977g/cm3 |
|---|---|
| Boiling Point | 309.3ºC at 760 mmHg |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.33800 |
| Flash Point | 141ºC |
| Exact Mass | 256.16700 |
| PSA | 52.60000 |
| LogP | 2.72120 |
| Index of Refraction | 1.446 |
| InChIKey | QEWHCHQTQURLGQ-UHFFFAOYSA-N |
| SMILES | C=CC(C(=O)OCC)(C(=O)OCC)C(C)CCC |
| HS Code | 2917190090 |
|---|
|
~%
diethyl (1-meth... CAS#:84100-22-1 |
|
Literature: Seefelder Festschrift C.Wurster |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Pentyl-vinyl-malonsaeure-diethylester |