Novaluron
Modify Date: 2025-08-21 19:32:37
Novaluron structure
|
Common Name | Novaluron | ||
|---|---|---|---|---|
| CAS Number | 116714-46-6 | Molecular Weight | 492.70500 | |
| Density | 1.601 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H9ClF8N2O4 | Melting Point | 177.5ºC | |
| MSDS | Chinese USA | Flash Point | 395.6 °F | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of NovaluronNovaluron is a chemical with pesticide properties, belonging to the class of insecticides called insect growth regulators. |
| Name | novaluron |
|---|---|
| Synonym | More Synonyms |
| Description | Novaluron is a chemical with pesticide properties, belonging to the class of insecticides called insect growth regulators. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.601 g/cm3 |
|---|---|
| Melting Point | 177.5ºC |
| Molecular Formula | C17H9ClF8N2O4 |
| Molecular Weight | 492.70500 |
| Exact Mass | 492.01200 |
| PSA | 76.66000 |
| LogP | 5.84760 |
| Index of Refraction | 1.513 |
| InChIKey | NJPPVKZQTLUDBO-UHFFFAOYSA-N |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(OC(F)(F)C(F)OC(F)(F)F)c(Cl)c1 |
| Storage condition | 0-6°C |
|
~%
Novaluron CAS#:116714-46-6 |
| Literature: EP271923 A1, ; |
|
~%
Novaluron CAS#:116714-46-6 |
| Literature: Gazzetta Chimica Italiana, , vol. 122, # 5-7 p. 253 - 259 |
|
~80%
Novaluron CAS#:116714-46-6 |
| Literature: Gazzetta Chimica Italiana, , vol. 122, # 5-7 p. 253 - 259 |
![3-Chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzenamine structure](https://image.chemsrc.com/caspic/038/116714-47-7.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (RS)-1-[3-chloro-4-(1,1,2-trifluoro-2-trifluoromethoxyethoxy)phenyl]-3-(2,6-difluorobenzoyl)urea |
| MFCD04112632 |
| Rimon |
| rac-N-({3-chloro-4-[(2R)-1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl}carbamoyl)-2,6-difluorobenzamide |
| N-[[[3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]amino]carbonyl]-2,6-difluorobenzamide |
| Novaluron |
| N-[[3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]carbamoyl]-2,6-difluorobenzamide |