4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile
Modify Date: 2025-08-20 17:08:53
4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile structure
|
Common Name | 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 116156-22-0 | Molecular Weight | 261.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile |
|---|
| Molecular Formula | C17H11NO2 |
|---|---|
| Molecular Weight | 261.27500 |
| Exact Mass | 261.07900 |
| PSA | 50.09000 |
| LogP | 3.02588 |
| InChIKey | XMVKHOBESLJQLW-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1 |
|
~%
4-(5-oxo-4-phen... CAS#:116156-22-0 |
| Literature: Fuji, Koji; Morimoto, Tsumoru; Tsutsumi, Ken; Kakiuchi, Kiyomi Chemical Communications, 2005 , # 26 p. 3295 - 3297 |
|
~%
4-(5-oxo-4-phen... CAS#:116156-22-0 |
| Literature: Navidpour, Latifeh; Amini, Mohsen; Shafaroodi, Hamed; Abdi, Khosrou; Ghahremani, Mohammad H.; Dehpour, Ahmad Reza; Shafiee, Abbas Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 17 p. 4483 - 4487 |
|
~%
4-(5-oxo-4-phen... CAS#:116156-22-0 |
| Literature: Navidpour, Latifeh; Amini, Mohsen; Shafaroodi, Hamed; Abdi, Khosrou; Ghahremani, Mohammad H.; Dehpour, Ahmad Reza; Shafiee, Abbas Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 17 p. 4483 - 4487 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |