3-Cyanovinylcarbazole phosphoramidite
Modify Date: 2025-08-21 07:56:23
3-Cyanovinylcarbazole phosphoramidite structure
|
Common Name | 3-Cyanovinylcarbazole phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 1157899-72-3 | Molecular Weight | 836.95300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C50H53N4O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Cyanovinylcarbazole phosphoramidite3-Cyanovinylcarbazole phosphoramidite is an antiviral drug that inhibits the synthesis of viral DNA. The modified nucleoside in the compound is synthesized by modifying the ribonucleotide with cyano group at the C-3 position, and can be used as a phosphoric acid amide for DNA synthesis[1]. |
| Name | 5'-O-(4,4'-dimethoxytrityl)-3-cyanovinylcarbazole-1'-β-deoxyriboside-3'-O-(cyanoethoxy-N,N-diisopropylamino)phosphoramidite |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Cyanovinylcarbazole phosphoramidite is an antiviral drug that inhibits the synthesis of viral DNA. The modified nucleoside in the compound is synthesized by modifying the ribonucleotide with cyano group at the C-3 position, and can be used as a phosphoric acid amide for DNA synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C50H53N4O6P |
|---|---|
| Molecular Weight | 836.95300 |
| Exact Mass | 836.37000 |
| PSA | 124.72000 |
| LogP | 11.30590 |
| InChIKey | NLRMEFDNJQEAHT-UHFFFAOYSA-N |
| SMILES | C=Cc1cc(C#N)cc2c1[nH]c1ccccc12.NP(O)O |
| 3-cyanovinylcarbazole phosphoramidite |