15,16-Dihydro-15-Methoxy-16-oxohardwickiic acid structure
|
Common Name | 15,16-Dihydro-15-Methoxy-16-oxohardwickiic acid | ||
|---|---|---|---|---|
| CAS Number | 115783-35-2 | Molecular Weight | 362.46 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 530.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.3±22.2 °C | |
Use of 15,16-Dihydro-15-Methoxy-16-oxohardwickiic acid15-Methoxypatagonic acidz (compound 2) is a clerodane diterpenoid compound isolated from the leaves of Casearia sylvestris[1]. |
| Name | (4aR,5S,6R,8aR)-5-[2-(5-Methoxy-2-oxo-2,5-dihydro-3-furanyl)ethyl ]-5,6,8a-trimethyl-3,4,4a,5,6,7,8,8a-octahydro-1-naphthalenecarbo xylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 15-Methoxypatagonic acidz (compound 2) is a clerodane diterpenoid compound isolated from the leaves of Casearia sylvestris[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 530.0±45.0 °C at 760 mmHg |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.46 |
| Flash Point | 182.3±22.2 °C |
| Exact Mass | 362.209320 |
| PSA | 72.83000 |
| LogP | 3.79 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | LKCDRCCSEGFFNK-UHFFFAOYSA-N |
| SMILES | COC1C=C(CCC2(C)C(C)CCC3(C)C(C(=O)O)=CCCC32)C(=O)O1 |
| Hazard Codes | Xi |
|---|
| 1-Naphthalenecarboxylic acid, 5-[2-(2,5-dihydro-5-methoxy-2-oxo-3-furanyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-5,6,8a-trimethyl-, (4aR,5S,6R,8aR)- |
| (4aR,5S,6R,8aR)-5-[2-(5-Methoxy-2-oxo-2,5-dihydro-3-furanyl)ethyl]-5,6,8a-trimethyl-3,4,4a,5,6,7,8,8a-octahydro-1-naphthalenecarboxylic acid |