2,2,2-trifluoro-N-[4-(2-hydroxyethyl)phenyl]acetamide structure
|
Common Name | 2,2,2-trifluoro-N-[4-(2-hydroxyethyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 115166-92-2 | Molecular Weight | 233.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-N-[4-(2-hydroxyethyl)phenyl]acetamide |
|---|
| Molecular Formula | C10H10F3NO2 |
|---|---|
| Molecular Weight | 233.18700 |
| Exact Mass | 233.06600 |
| PSA | 49.33000 |
| LogP | 1.79520 |
| InChIKey | ZEZDUYNOZBHUCD-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(CCO)cc1)C(F)(F)F |
|
~60%
2,2,2-trifluoro... CAS#:115166-92-2 |
| Literature: Suga, Hiroaki; Ersoy, Oguz; Tsumuraya, Takeshi; Lee, Jung; Sinskey, Anthony J.; Masamune, Satoru Journal of the American Chemical Society, 1994 , vol. 116, # 2 p. 487 - 494 |
|
~%
2,2,2-trifluoro... CAS#:115166-92-2 |
| Literature: KISSEI PHARMACEUTICAL CO., LTD. Patent: US2003/166719 A1, 2003 ; |
|
~93%
2,2,2-trifluoro... CAS#:115166-92-2 |
| Literature: Prashad; Hu; Har; Repic; Blacklock Tetrahedron Letters, 2000 , vol. 41, # 51 p. 9957 - 9961 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |