II-B08
Modify Date: 2025-11-25 11:29:34
II-B08 structure
|
Common Name | II-B08 | ||
|---|---|---|---|---|
| CAS Number | 1143579-78-5 | Molecular Weight | 557.599 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C33H27N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of II-B08II-B08 is a reversible and noncompetitive SHP2 inhibitor (IC50: 5.5 μM, 15.7, 14.3 μM for SHP2, SHP1, PTP1B). II-B08 can be used for cancer research[1]. |
| Name | 3-{1-[3-(4-Biphenylylamino)-3-oxopropyl]-1H-1,2,3-triazol-4-yl}-6-hydroxy-1-methyl-2-phenyl-1H-indole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | II-B08 is a reversible and noncompetitive SHP2 inhibitor (IC50: 5.5 μM, 15.7, 14.3 μM for SHP2, SHP1, PTP1B). II-B08 can be used for cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C33H27N5O4 |
| Molecular Weight | 557.599 |
| Exact Mass | 557.206299 |
| LogP | 6.22 |
| Index of Refraction | 1.694 |
| InChIKey | RATFAFAWIWHLMR-UHFFFAOYSA-N |
| SMILES | Cn1c(-c2ccccc2)c(-c2cn(CCC(=O)Nc3ccc(-c4ccccc4)cc3)nn2)c2cc(C(=O)O)c(O)cc21 |
| 3-{1-[3-(4-Biphenylylamino)-3-oxopropyl]-1H-1,2,3-triazol-4-yl}-6-hydroxy-1-methyl-2-phenyl-1H-indole-5-carboxylic acid |
| 3-{1-[3-(biphenyl-4-ylamino)-3-oxopropyl]-1H-1,2,3-triazol-4-yl}-6-hydroxy-1-methyl-2-phenyl-1H-indole-5-carboxylic acid |
| 1H-Indole-5-carboxylic acid, 3-[1-[3-([1,1'-biphenyl]-4-ylamino)-3-oxopropyl]-1H-1,2,3-triazol-4-yl]-6-hydroxy-1-methyl-2-phenyl- |