1-chloro-4-[(4-chlorophenyl)-diazomethyl]benzene structure
|
Common Name | 1-chloro-4-[(4-chlorophenyl)-diazomethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 1143-92-6 | Molecular Weight | 263.12200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-[(4-chlorophenyl)-diazomethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8Cl2N2 |
|---|---|
| Molecular Weight | 263.12200 |
| Exact Mass | 262.00600 |
| PSA | 37.39000 |
| LogP | 4.14166 |
| InChIKey | RBYYFMWIKIJOTA-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| HS Code | 2927000090 |
|---|
|
~%
1-chloro-4-[(4-... CAS#:1143-92-6 |
| Literature: Sidgwick; Thomas; Sutton Journal of the Chemical Society, 1933 , p. 406 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p,p'-dichlorodiphenyldiazomethane |
| 4,4'-Dichlorodiphenyldiazomethane |