1-chloro-4-[(4-chlorophenyl)-propan-2-yloxymethyl]benzene structure
|
Common Name | 1-chloro-4-[(4-chlorophenyl)-propan-2-yloxymethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 121043-48-9 | Molecular Weight | 295.20400 | |
| Density | 1.182g/cm3 | Boiling Point | 363.1ºC at 760 mmHg | |
| Molecular Formula | C16H16Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 61.7ºC | |
| Name | 1-chloro-4-[(4-chlorophenyl)-propan-2-yloxymethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 363.1ºC at 760 mmHg |
| Molecular Formula | C16H16Cl2O |
| Molecular Weight | 295.20400 |
| Flash Point | 61.7ºC |
| Exact Mass | 294.05800 |
| PSA | 9.23000 |
| LogP | 5.50780 |
| Vapour Pressure | 3.86E-05mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | SOFVYKVWGANHKY-UHFFFAOYSA-N |
| SMILES | CC(C)OC(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|
~%
1-chloro-4-[(4-... CAS#:121043-48-9 |
| Literature: Bethell,D.; Howard,R.D. Journal of the Chemical Society [Section] B: Physical Organic, 1968 , p. 430 - 434 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Bis-(p-chlor-phenyl)-methyl-isopropyl-aether |
| 1-Chloro-4-((4-chlorophenyl)-propan-2-yloxymethyl)benzene |