Imatinib D4 structure
|
Common Name | Imatinib D4 | ||
|---|---|---|---|---|
| CAS Number | 1134803-16-9 | Molecular Weight | 497.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H27D4N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Imatinib D4Imatinib D4 (STI571 D4) is a deuterium labeled Imatinib (STI571). Imatinib is an orally bioavailable tyrosine kinases inhibitor that selectively inhibits BCR/ABL, v-Abl, PDGFR and c-kit kinase activity[1][2]. |
| Name | Imatinib D4 |
|---|
| Description | Imatinib D4 (STI571 D4) is a deuterium labeled Imatinib (STI571). Imatinib is an orally bioavailable tyrosine kinases inhibitor that selectively inhibits BCR/ABL, v-Abl, PDGFR and c-kit kinase activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H27D4N7O |
|---|---|
| Molecular Weight | 497.63 |
| InChIKey | KTUFNOKKBVMGRW-YKVCKAMESA-N |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1 |
| Hazard Codes | Xi |
|---|