3-Methoxy-4-hydroxycinnamyl β-D-glucopyranoside structure
|
Common Name | 3-Methoxy-4-hydroxycinnamyl β-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 113349-27-2 | Molecular Weight | 342.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Methoxy-4-hydroxycinnamyl β-D-glucopyranoside(E)-Isoconiferin is a compound synthesized from vanillin, syringaldehyde, and p-hydroxybenzaldehyde, by five reaction steps in high overall yield[1]. |
| Name | citrusin D |
|---|---|
| Synonym | More Synonyms |
| Description | (E)-Isoconiferin is a compound synthesized from vanillin, syringaldehyde, and p-hydroxybenzaldehyde, by five reaction steps in high overall yield[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H22O8 |
|---|---|
| Molecular Weight | 342.34 |
| Exact Mass | 342.13100 |
| PSA | 128.84000 |
| InChIKey | JOIDTHZGWZZGMU-FAOXUISGSA-N |
| SMILES | COc1cc(C=CCOC2OC(CO)C(O)C(O)C2O)ccc1O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| .3-(4-hydroxy-3-methoxy)-phenyl-2E-propenyl-1 |
| .trans-isoconiferin |
| .isoconiferin |