3-(4-Hydroxyphenyl)-3-oxopropyl β-D-glucopyranoside structure
|
Common Name | 3-(4-Hydroxyphenyl)-3-oxopropyl β-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 53170-92-6 | Molecular Weight | 328.31 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 641.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O8 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 239.2±25.0 °C | |
Use of 3-(4-Hydroxyphenyl)-3-oxopropyl β-D-glucopyranosideDescription Natural product derived from plant source.} |
| Name | 3-(4-Hydroxyphenyl)-3-oxopropyl β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 641.2±55.0 °C at 760 mmHg |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.31 |
| Flash Point | 239.2±25.0 °C |
| Exact Mass | 328.115814 |
| LogP | -1.25 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | NPAQHLFPEOMKAL-UXXRCYHCSA-N |
| SMILES | O=C(CCOC1OC(CO)C(O)C(O)C1O)c1ccc(O)cc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| MFCD24849339 |