Tokinolide B structure
|
Common Name | Tokinolide B | ||
|---|---|---|---|---|
| CAS Number | 112966-16-2 | Molecular Weight | 380.477 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 644.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.5±29.9 °C | |
Use of Tokinolide BTokinolide B is isolated from the rhizomes of Ligusticum porter[1]. |
| Name | (1S,3a'S,5'R,6'R,Z)-3'-butylidene-5'-propyl-5',6,6',7-tetrahydro-1'H,3H,3'H-spiro[isobenzofuran-1,4'-[3a,6]ethanoisobenzofuran]-1',3-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Tokinolide B is isolated from the rhizomes of Ligusticum porter[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 644.2±55.0 °C at 760 mmHg |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.477 |
| Flash Point | 338.5±29.9 °C |
| Exact Mass | 380.198761 |
| PSA | 52.60000 |
| LogP | 5.22 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | DZMFTLLDUYBHLI-MUSNRYMWSA-N |
| SMILES | CCCC=C1OC(=O)C2=CC3CCC12C1(OC(=O)C2=C1CCC=C2)C3CCC |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|
| (1S,1'S,2'Z,7'R,8'R)-2'-Butylidene-8'-propyl-6,7-dihydro-3H,4'H-spiro[2-benzofuran-1,9'-[3]oxatricyclo[5.2.2.0]undec[5]ene]-3,4'-dione |
| Tokinolide B |