SKLB 610
Modify Date: 2025-09-10 06:57:53
SKLB 610 structure
|
Common Name | SKLB 610 | ||
|---|---|---|---|---|
| CAS Number | 1125780-41-7 | Molecular Weight | 415.365 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 500.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H16F3N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.8±30.1 °C | |
Use of SKLB 610SKLB610, a novel multi-targeted inhibitor, inhibits angiogenesis-related tyrosine kinase VEGFR2, FGFR2 and PDGFR at rate of 97%, 65% and 55%, respectively, at concentration of 10 μM in biochemical kinase assays. |
| Name | N-Methyl-4-(4-{[3-(trifluoromethyl)benzoyl]amino}phenoxy)-2-pyridinecarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 500.9±50.0 °C at 760 mmHg |
| Molecular Formula | C21H16F3N3O3 |
| Molecular Weight | 415.365 |
| Flash Point | 256.8±30.1 °C |
| Exact Mass | 415.114380 |
| LogP | 3.49 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | WACDHHMEVMSODJ-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)c3cccc(C(F)(F)F)c3)cc2)ccn1 |
| Storage condition | -20℃ |
| 2-Pyridinecarboxamide, N-methyl-4-[4-[[3-(trifluoromethyl)benzoyl]amino]phenoxy]- |
| N-Methyl-4-(4-{[3-(trifluoromethyl)benzoyl]amino}phenoxy)-2-pyridinecarboxamide |
| SKLB 610 |
| SKLB610 |