Ochromycinone
Modify Date: 2025-08-27 16:22:09
Ochromycinone structure
|
Common Name | Ochromycinone | ||
|---|---|---|---|---|
| CAS Number | 111540-00-2 | Molecular Weight | 306.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of OchromycinoneOchromycinone ((Rac)-STA-21) is a natural antibiotic and a STAT3 inhibitor. Ochromycinone can inhibits STAT3 DNA binding activity, STAT3 dimerization. Ochromycinone has anticancer and antimicrobial activity[1][2]. |
| Name | (+/-)-ochromycinone |
|---|---|
| Synonym | More Synonyms |
| Description | Ochromycinone ((Rac)-STA-21) is a natural antibiotic and a STAT3 inhibitor. Ochromycinone can inhibits STAT3 DNA binding activity, STAT3 dimerization. Ochromycinone has anticancer and antimicrobial activity[1][2]. |
|---|---|
| Related Catalog | |
| Target |
STAT3 |
| In Vitro | STA-21 inhibits STAT3 DNA binding activity, STAT3 dimerization, and STAT3-dependent luciferase activity. Moreover, STA-21 reduces the survival of breast carcinoma cells with constitutive STAT3 signaling but has minimal effect on the cells in which constitutive STAT3 signaling is absent[2]. |
| References |
| Molecular Formula | C19H14O4 |
|---|---|
| Molecular Weight | 306.31200 |
| Exact Mass | 306.08900 |
| PSA | 71.44000 |
| LogP | 2.93260 |
| InChIKey | ZAWXOCUFQSQDJS-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)c2c(ccc3c2C(=O)c2cccc(O)c2C3=O)C1 |
| Storage condition | -20℃ |
| ochromycinone |
| STA-021 |
| Ochromycinon, 8-Hydroxy-3-methyl-1-oxo-1,2,3,4-tetrahydrobenz(a)anthrachinon |
| Ochromycinon, 8-Hydroxy-3-methyl-1-oxo-1,2,3,4-tetrahydrobenz[a]anthrachinon |
| STA-21 |