Nyasicol
Modify Date: 2025-08-22 17:37:11
Nyasicol structure
|
Common Name | Nyasicol | ||
|---|---|---|---|---|
| CAS Number | 111518-95-7 | Molecular Weight | 316.305 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 698.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335.6±26.1 °C | |
Use of NyasicolNyasicol ((+)-Nyasicol) is an enzymatic (β-glucosidase) hydrolysis product of Compound 3[1]. |
| Name | 4,4'-[(4R,5R)-4,5-Dihydroxy-1-pentyne-1,5-diyl]di(1,2-benzenediol ) |
|---|---|
| Synonym | More Synonyms |
| Description | Nyasicol ((+)-Nyasicol) is an enzymatic (β-glucosidase) hydrolysis product of Compound 3[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 698.3±55.0 °C at 760 mmHg |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.305 |
| Flash Point | 335.6±26.1 °C |
| Exact Mass | 316.094696 |
| PSA | 121.38000 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.756 |
| InChIKey | AJTKBQHYQXHTTQ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C#CCC(O)C(O)c2ccc(O)c(O)c2)cc1O |
| Hazard Codes | Xi |
|---|
| 4,4'-[(4R,5R)-4,5-Dihydroxy-1-pentyne-1,5-diyl]di(1,2-benzenediol) |
| 1,2-Benzenediol, 4,4'-[(4R,5R)-4,5-dihydroxy-1-pentyne-1,5-diyl]bis- |