neopentyl glycol mono(hydroxypivalate) structure
|
Common Name | neopentyl glycol mono(hydroxypivalate) | ||
|---|---|---|---|---|
| CAS Number | 1115-20-4 | Molecular Weight | 204.26300 | |
| Density | 1.01 | Boiling Point | 292°C | |
| Molecular Formula | C10H20O4 | Melting Point | 46-50°C | |
| MSDS | N/A | Flash Point | 292°C | |
| Name | neopentyl glycol mono(hydroxypivalate) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01 |
|---|---|
| Boiling Point | 292°C |
| Melting Point | 46-50°C |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.26300 |
| Flash Point | 292°C |
| Exact Mass | 204.13600 |
| PSA | 66.76000 |
| LogP | 0.56660 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | SZCWBURCISJFEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)COC(=O)C(C)(C)CO |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36 |
| Safety Phrases | S26-S36 |
| HS Code | 2918199090 |
|
~%
neopentyl glyco... CAS#:1115-20-4
Detail
|
| Literature: US2007/78270 A1, ; Page/Page column 4 ; |
|
~%
neopentyl glyco... CAS#:1115-20-4
Detail
|
| Literature: EP1568678 A1, ; Page/Page column 5 ; |
|
~%
Detail
|
| Literature: US2007/32682 A1, ; Page/Page column 4; 6; 7 ; |
|
~%
neopentyl glyco... CAS#:1115-20-4 |
| Literature: Tetrahedron Letters, , vol. 42, # 14 p. 2743 - 2746 |
|
~%
neopentyl glyco... CAS#:1115-20-4 |
| Literature: Monatshefte fuer Chemie, , vol. 25, p. 866 |
|
~%
neopentyl glyco... CAS#:1115-20-4 |
| Literature: Liebigs Annalen der Chemie, , p. 1591 - 1601 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Neopentyl Glycol Mono(hydroxypivalate) |
| 2,2-Dimethyl-1,3-propanediol Mono(hydroxypivalate) |
| (3-hydroxy-2,2-dimethylpropyl) 3-hydroxy-2,2-dimethylpropanoate |
| MFCD00059597 |
| EINECS 214-222-2 |
| 3-Hydroxy-2,2-dimethylpropyl 3-Hydroxy-2,2-dimethylpropionate |
| Hydroxypivalic Acid Neopentyl Glycol Ester |