3-Methyladenine-d3 structure
|
Common Name | 3-Methyladenine-d3 | ||
|---|---|---|---|---|
| CAS Number | 110953-39-4 | Molecular Weight | 152.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4D3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Methyladenine-d33-Methyladenine-d3 is the deuterium labeled 3-Methyladenine[1]. 3-Methyladenine (3-MA) is a PI3K inhibitor. 3-Methyladenine is a widely used inhibitor of autophagy via its inhibitory effect on class III PI3K[2]. |
| Name | 3-(trideuteriomethyl)purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Methyladenine-d3 is the deuterium labeled 3-Methyladenine[1]. 3-Methyladenine (3-MA) is a PI3K inhibitor. 3-Methyladenine is a widely used inhibitor of autophagy via its inhibitory effect on class III PI3K[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C6H4D3N5 |
|---|---|
| Molecular Weight | 152.17200 |
| Exact Mass | 152.08900 |
| PSA | 69.62000 |
| LogP | 0.52670 |
| InChIKey | ZPBYVFQJHWLTFB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC(=N)C2=C1N=CN2 |
| 3-(Methyl-d3)-6-aminopurine |
| N3-(Methyl-d3)adenine |
| 3-Methyl Adenine-d3 |
| 3-Methyl-d3-adenine |
| 6-Amino-3-(methyl-d3)purine |
| 3-(Methyl-d3)-3H-purin-6-amine |