Wilforine structure
|
Common Name | Wilforine | ||
|---|---|---|---|---|
| CAS Number | 11088-09-8 | Molecular Weight | 867.845 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 871.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C43H49NO18 | Melting Point | 158-163ºC | |
| MSDS | N/A | Flash Point | 480.9±34.3 °C | |
Use of WilforineWilforine is a sesquiterpene pyridine alkaloid; importantbioactive compound in T. wilfordii plants, and is effective intreating idiopathic pulmonary fibrosis. |
| Name | Wilforine |
|---|---|
| Synonym | More Synonyms |
| Description | Wilforine is a sesquiterpene pyridine alkaloid; importantbioactive compound in T. wilfordii plants, and is effective intreating idiopathic pulmonary fibrosis. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 871.5±65.0 °C at 760 mmHg |
| Melting Point | 158-163ºC |
| Molecular Formula | C43H49NO18 |
| Molecular Weight | 867.845 |
| Flash Point | 480.9±34.3 °C |
| Exact Mass | 867.294983 |
| PSA | 252.75000 |
| LogP | 6.24 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | ZOCKGJZEUVPPPI-NCHBRQRASA-N |
| SMILES | CC(=O)OCC12C(OC(C)=O)C(OC(C)=O)C3C(OC(C)=O)C14OC3(C)COC(=O)c1cccnc1CCC(C)C(=O)OC(C(OC(=O)c1ccccc1)C2OC(C)=O)C4(C)O |
| Storage condition | 2-8℃ |
| (1S,3R,15S,18S,19R,20R,21R,22S,23R,24R,25R,26S)-20,22,23,25-Tetraacetoxy-21-(acetoxymethyl)-26-hydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.0.0.0]hexaco sa-7,9,11-trien-19-yl benzoate |
| 20,22,23,25-Tetraacetoxy-21-(acetoxymethyl)-26-hydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.0.0.0]hexacosa-7,9,11-trien-19-yl benzoate |
| 26-Deoxywilfordine |