Flavone, 3-hydroxy-4',5,7-trimethoxy-
Modify Date: 2025-08-21 19:15:28
Flavone, 3-hydroxy-4',5,7-trimethoxy- structure
|
Common Name | Flavone, 3-hydroxy-4',5,7-trimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 1098-92-6 | Molecular Weight | 328.32 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 529.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H16O6 | Melting Point | 150-153℃ | |
| MSDS | N/A | Flash Point | 194.3±23.6 °C | |
Use of Flavone, 3-hydroxy-4',5,7-trimethoxy-3-Hydroxy-5,7,4′-trimethoxyflavone is a flavonol can be isolated from Cucubalus baccifer (L.)[1]. |
| Name | 3-hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Hydroxy-5,7,4′-trimethoxyflavone is a flavonol can be isolated from Cucubalus baccifer (L.)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.6±50.0 °C at 760 mmHg |
| Melting Point | 150-153℃ |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 |
| Flash Point | 194.3±23.6 °C |
| Exact Mass | 328.094696 |
| PSA | 78.13000 |
| LogP | 3.38 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | SGPXJCVFCJANKN-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(OC)cc(OC)c3c(=O)c2O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:520-18-3| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4H-1-Benzopyran-4-one, 3-hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)- |
| 3-Hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Flavone, 3-hydroxy-4',5,7-trimethoxy- |