9-methoxy-4-nitrofuro[3,2-g]chromene-7-thione
Modify Date: 2025-11-25 20:00:59
![9-methoxy-4-nitrofuro[3,2-g]chromene-7-thione Structure](https://image.chemsrc.com/caspic/002/109018-54-4.png)
9-methoxy-4-nitrofuro[3,2-g]chromene-7-thione structure
|
Common Name | 9-methoxy-4-nitrofuro[3,2-g]chromene-7-thione | ||
|---|---|---|---|---|
| CAS Number | 109018-54-4 | Molecular Weight | 277.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-methoxy-4-nitrofuro[3,2-g]chromene-7-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7NO5S |
|---|---|
| Molecular Weight | 277.25300 |
| Exact Mass | 277.00400 |
| PSA | 113.42000 |
| LogP | 4.34850 |
| InChIKey | PJDUKBWBEFNNNK-UHFFFAOYSA-N |
| SMILES | COc1c2occc2c([N+](=O)[O-])c2ccc(=S)oc12 |
|
~%
9-methoxy-4-nit... CAS#:109018-54-4 |
| Literature: Brokke; Christensen Journal of Organic Chemistry, 1958 , vol. 23, p. 589,594 |
|
~%
9-methoxy-4-nit... CAS#:109018-54-4 |
| Literature: Brokke; Christensen Journal of Organic Chemistry, 1958 , vol. 23, p. 589,594 |
![7H-Furo[3,4-g][1]benzopyran-7-one, 9-methoxy-4-nitro- (8CI 9CI) structure](https://image.chemsrc.com/caspic/253/1930-56-9.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-Methoxy-4-nitro-furo[3,2-g]chromen-7-thion |
| 7H-Furo[3,2-g][1]benzopyran-7-thione,9-methoxy-4-nitro |
| 9-methoxy-4-nitro-furo[3,2-g]chromene-7-thione |