7H-Furo[3,4-g][1]benzopyran-7-one, 9-methoxy-4-nitro- (8CI 9CI) structure
|
Common Name | 7H-Furo[3,4-g][1]benzopyran-7-one, 9-methoxy-4-nitro- (8CI 9CI) | ||
|---|---|---|---|---|
| CAS Number | 1930-56-9 | Molecular Weight | 261.18700 | |
| Density | 1.537g/cm3 | Boiling Point | 505.6ºC at 760 mmHg | |
| Molecular Formula | C12H7NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.6ºC | |
| Name | 9-methoxy-4-nitrofuro[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.537g/cm3 |
|---|---|
| Boiling Point | 505.6ºC at 760 mmHg |
| Molecular Formula | C12H7NO6 |
| Molecular Weight | 261.18700 |
| Flash Point | 259.6ºC |
| Exact Mass | 261.02700 |
| PSA | 98.40000 |
| LogP | 2.97920 |
| Vapour Pressure | 2.39E-10mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | CFMUZTVJQKVMAZ-UHFFFAOYSA-N |
| SMILES | COc1c2occc2c([N+](=O)[O-])c2ccc(=O)oc12 |
|
~95%
7H-Furo[3,4-g][... CAS#:1930-56-9 |
| Literature: Zhang, Bang-Le; Fan, Cheng-Qi; Dong, Lei; Wang, Fang-Dao; Yue, Jian-Min European Journal of Medicinal Chemistry, 2010 , vol. 45, # 11 p. 5258 - 5264 |
| 5-nitro-8-fluoro-quinoline |
| 8-Methoxy-5-nitro-psoralen,Nitroxanthotoxin |
| 4-nitro-9-methoxy-7H-furo<3,2-g><1>benzopyran-7-one |
| Quinoline,8-fluoro-5-nitro |
| 5-Nitro-xanthotoxin |
| 4-Nitro-xanthotoxin |
| 5-Nitro-8-methoxypsoralen |