9-methoxy-4-(methoxymethyl)furo[3,2-g]chromen-7-one
Modify Date: 2025-08-20 10:42:01
![9-methoxy-4-(methoxymethyl)furo[3,2-g]chromen-7-one Structure](https://image.chemsrc.com/caspic/346/50639-52-6.png)
9-methoxy-4-(methoxymethyl)furo[3,2-g]chromen-7-one structure
|
Common Name | 9-methoxy-4-(methoxymethyl)furo[3,2-g]chromen-7-one | ||
|---|---|---|---|---|
| CAS Number | 50639-52-6 | Molecular Weight | 260.24200 | |
| Density | 1.319g/cm3 | Boiling Point | 444.7ºC at 760 mmHg | |
| Molecular Formula | C14H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7ºC | |
| Name | 9-methoxy-4-(methoxymethyl)furo[3,2-g]chromen-7-one |
|---|
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 444.7ºC at 760 mmHg |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.24200 |
| Flash Point | 222.7ºC |
| Exact Mass | 260.06800 |
| PSA | 61.81000 |
| LogP | 2.69420 |
| Index of Refraction | 1.604 |
| InChIKey | ADISAXBOSWJNRL-UHFFFAOYSA-N |
| SMILES | COCc1c2ccoc2c(OC)c2oc(=O)ccc12 |
|
~%
9-methoxy-4-(me... CAS#:50639-52-6 |
| Literature: Wulff, Heike; Rauer, Heiko; Duering, Tim; Hanselmann, Christine; Ruff, Katharina; Wrisch, Anja; Grissmer, Stephan; Haensel, Wolfram Journal of Medicinal Chemistry, 1998 , vol. 41, # 23 p. 4542 - 4549 |
|
~57%
9-methoxy-4-(me... CAS#:50639-52-6 |
| Literature: Zhang, Bang-Le; Fan, Cheng-Qi; Dong, Lei; Wang, Fang-Dao; Yue, Jian-Min European Journal of Medicinal Chemistry, 2010 , vol. 45, # 11 p. 5258 - 5264 |
![7H-Furo[3,2-g][1]benzopyran-7-one, 4-(chloromethyl)-9-methoxy- structure](https://image.chemsrc.com/caspic/106/43111-03-1.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |