Triclabendazole sulfone
Modify Date: 2025-09-10 21:42:58
Triclabendazole sulfone structure
|
Common Name | Triclabendazole sulfone | ||
|---|---|---|---|---|
| CAS Number | 106791-37-1 | Molecular Weight | 391.65700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9Cl3N2O3S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfonyl-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9Cl3N2O3S |
|---|---|
| Molecular Weight | 391.65700 |
| Exact Mass | 389.94000 |
| PSA | 80.43000 |
| LogP | 5.79970 |
| InChIKey | ZEIHWBIRYIXBSV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1nc2cc(Oc3cccc(Cl)c3Cl)c(Cl)cc2[nH]1 |
| Storage condition | -20°C |
| RIDADR | NONH for all modes of transport |
|---|
|
The small molecule triclabendazole decreases the intracellular level of cyclic AMP and increases resistance to stress in Saccharomyces cerevisiae.
PLoS ONE 8 , e64337, (2013) The Ras-adenylyl cyclase-protein kinase A nutrient-sensing pathway controls metabolism, proliferation and resistance to stress in Saccharomyces cerevisiae. The genetic disruption of this pathway incre... |
| Triclabendazole sulfone |
| triclabendazole sulphone |
| 5-Chloro-6-(2,3-dichlorophenoxy)-2-(methylsulfonyl)-1H-benzimidazole |