Aloenin B
Modify Date: 2025-08-25 19:19:14
Aloenin B structure
|
Common Name | Aloenin B | ||
|---|---|---|---|---|
| CAS Number | 106533-41-9 | Molecular Weight | 718.65500 | |
| Density | 1.6g/cm3 | Boiling Point | 1047.9ºC at 760 mmHg | |
| Molecular Formula | C34H38O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.4ºC | |
Use of Aloenin BAloenin B (Compound 16) is a compound isolated from the leaves and roots of Aloe hijazensis[1]. |
| Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-(4-methoxy-6-oxopyran-2-yl)-3-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxy]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|
| Description | Aloenin B (Compound 16) is a compound isolated from the leaves and roots of Aloe hijazensis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 1047.9ºC at 760 mmHg |
| Molecular Formula | C34H38O17 |
| Molecular Weight | 718.65500 |
| Flash Point | 330.4ºC |
| Exact Mass | 718.21100 |
| PSA | 264.50000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | IZBGWXJOIXZDBF-WLFSTHIVSA-N |
| SMILES | COc1cc(-c2c(C)cc(OC3OC(CO)C(O)C(O)C3O)cc2OC2OC(CO)C(O)C(O)C2OC(=O)C=Cc2ccc(O)cc2)oc(=O)c1 |
| Storage condition | -20°C |
| Hazard Codes | Xn |
|---|