Quinhydrone structure
|
Common Name | Quinhydrone | ||
|---|---|---|---|---|
| CAS Number | 106-34-3 | Molecular Weight | 218.20500 | |
| Density | 1.32 | Boiling Point | 285 °C | |
| Molecular Formula | C12H10O4 | Melting Point | 167-172 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 141.6ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | quinhydrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 |
|---|---|
| Boiling Point | 285 °C |
| Melting Point | 167-172 °C(lit.) |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.20500 |
| Flash Point | 141.6ºC |
| Exact Mass | 218.05800 |
| PSA | 74.60000 |
| LogP | 1.34840 |
| Vapour Pressure | 0.00157mmHg at 25°C |
| InChIKey | BDJXVNRFAQSMAA-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)C=C1.Oc1ccc(O)cc1 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | 4 g/L (20 ºC) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful;N:Dangerousfortheenvironment; |
| Risk Phrases | R22;R36/37/38;R50 |
| Safety Phrases | 26-36-61-37/39-29 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | VA4550000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2907299090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
|
Tenebrionid secretions and a fungal benzoquinone oxidoreductase form competing components of an arms race between a host and pathogen.
Proc. Natl. Acad. Sci. U. S. A. 112 , E3651-60, (2015) Entomopathogenic fungi and their insect hosts represent a model system for examining invertebrate-pathogen coevolutionary selection processes. Here we report the characterization of competing componen... |
|
|
Positional adaptability in the design of mutation-resistant nonnucleoside HIV-1 reverse transcriptase inhibitors: a supramolecular perspective.
AIDS Res. Hum. Retroviruses 29(1) , 4-12, (2013) Drug resistance is a key cause of failed treatment of HIV infection. The efficacy of nonnucleoside reverse transcriptase-inhibiting (NNRTI) drugs is impaired by the rapid emergence of drug-resistant m... |
|
|
The effect of the hydrogen ion concentration upon the salt error of the quinhydrone electrode.
J. Am. Chem. Soc. 69(3) , 533-6, (1947)
|
| EINECS 203-387-6 |
| Quinhydrone |
| benzene-1,4-diol,cyclohexa-2,5-diene-1,4-dione |
| 2,5-Cyclohexadiene-1,4-dione,compd.with1,4-benzenediol(1:1) |
| MFCD00010310 |