PLSRTLSVAAKK structure
|
Common Name | PLSRTLSVAAKK | ||
|---|---|---|---|---|
| CAS Number | 105802-84-4 | Molecular Weight | 1270.52000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C56H103N17O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PLSRTLSVAAKK[Ala9,10, Lys11,12] Glycogen Synthase (1-12) is a selective substrate for phosphorylation by protein kinase C (PKC). [Ala9,10, Lys11,12] Glycogen Synthase (1-12) can be used to determine the activity of protein kinase C[1]. |
| Name | h-pro-leu-ser-arg-thr-leu-ser-val-ala-ala-lys-lys-oh |
|---|---|
| Synonym | More Synonyms |
| Description | [Ala9,10, Lys11,12] Glycogen Synthase (1-12) is a selective substrate for phosphorylation by protein kinase C (PKC). [Ala9,10, Lys11,12] Glycogen Synthase (1-12) can be used to determine the activity of protein kinase C[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C56H103N17O16 |
|---|---|
| Molecular Weight | 1270.52000 |
| Exact Mass | 1269.78000 |
| PSA | 544.06000 |
| LogP | 1.05070 |
| InChIKey | AATOURFPKKEISN-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C1CCCN1)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)O)C(C)C)C(C)O |
| WGK Germany | 3 |
|---|
| [ala9,10,lys11,12]-glycogen synthase (1-12) |
| plsrtlsvaakk dye-labeled |
| glycogen synthase 1-8 [plsrtlsvaakk-nh2] |
| plsrtlsvaakk |
| pro-leu-ser-arg-thr-leu-ser-val-ala-ala-lys-lys |
| glycogen synthase peptide dye-labeled |