PKC Substrate 2
Modify Date: 2025-09-09 15:25:43
PKC Substrate 2 structure
|
Common Name | PKC Substrate 2 | ||
|---|---|---|---|---|
| CAS Number | 105802-82-2 | Molecular Weight | 1197.48000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C51H100N22O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PKC Substrate 2Protein kinase C substrate is a substrate of Protein kinase C, can be used to detect protein. Protein kinase C is a key regulatory element in signal transduction and exerts its effects by catalysing specific substrate phosphorylation[1]. |
| Name | h-val-arg-lys-arg-thr-leu-arg-arg-leu-oh |
|---|---|
| Synonym | More Synonyms |
| Description | Protein kinase C substrate is a substrate of Protein kinase C, can be used to detect protein. Protein kinase C is a key regulatory element in signal transduction and exerts its effects by catalysing specific substrate phosphorylation[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C51H100N22O11 |
|---|---|
| Molecular Weight | 1197.48000 |
| Exact Mass | 1196.79000 |
| PSA | 589.97000 |
| LogP | 3.87930 |
| InChIKey | PBWMKSKSLNNGHP-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)C(C)C)C(C)O)C(=O)O |
| WGK Germany | 3 |
|---|
| vrkrtlrrl |
| protein kinase c substrate |
| val-arg-lys-arg-thr-leu-arg-arg-leu |
| pkc substrate 2 |
| pkc substrate |