Mytoxin B
Modify Date: 2025-09-11 20:39:08
Mytoxin B structure
|
Common Name | Mytoxin B | ||
|---|---|---|---|---|
| CAS Number | 105049-15-8 | Molecular Weight | 528.59100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H36O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mytoxin BMytoxin B is an ADC cytotoxin. Mytoxin B is a satratoxin-type trichothecene macrolide and is similar to the effect of LY294002 (HY-10108). Mytoxin B induces cell apoptosis via PI3K/Akt pathway[1]. |
| Name | mytoxin B |
|---|
| Description | Mytoxin B is an ADC cytotoxin. Mytoxin B is a satratoxin-type trichothecene macrolide and is similar to the effect of LY294002 (HY-10108). Mytoxin B induces cell apoptosis via PI3K/Akt pathway[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H36O9 |
|---|---|
| Molecular Weight | 528.59100 |
| Exact Mass | 528.23600 |
| PSA | 120.89000 |
| LogP | 2.49970 |
| InChIKey | LXIQXFWXXPJPEE-QZAJVOIVSA-N |
| SMILES | CC(=O)C12CCC=CC(=O)OC3CC4OC5C=C(C)CCC5(COC(=O)C=C(CCO1)C2O)C3(C)C41CO1 |