2-Nitroanthra(1,2-b)furan structure
|
Common Name | 2-Nitroanthra(1,2-b)furan | ||
|---|---|---|---|---|
| CAS Number | 104662-23-9 | Molecular Weight | 263.24800 | |
| Density | 1.412g/cm3 | Boiling Point | 481.3ºC at 760mmHg | |
| Molecular Formula | C16H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.9ºC | |
| Name | 2-nitronaphtho[2,3-g][1]benzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 481.3ºC at 760mmHg |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.24800 |
| Flash Point | 244.9ºC |
| Exact Mass | 263.05800 |
| PSA | 58.96000 |
| LogP | 5.17060 |
| Vapour Pressure | 5.9E-09mmHg at 25°C |
| Index of Refraction | 1.785 |
| InChIKey | SKKPTIULHWFSGR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2ccc3cc4ccccc4cc3c2o1 |
| HS Code | 2932999099 |
|---|
|
~%
2-Nitroanthra(1... CAS#:104662-23-9 |
| Literature: Bilger; Demerseman; Royer Journal of Heterocyclic Chemistry, 1985 , vol. 22, # 3 p. 735 - 739 |
|
~18%
2-Nitroanthra(1... CAS#:104662-23-9 |
| Literature: Bilger; Demerseman; Royer Journal of Heterocyclic Chemistry, 1985 , vol. 22, # 3 p. 735 - 739 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| R-7688 |
| nitro-2 anthra<1,2-b>furanne |