2-NITRO-5-METHOXYNAPHTHO(1,2-B)FURAN structure
|
Common Name | 2-NITRO-5-METHOXYNAPHTHO(1,2-B)FURAN | ||
|---|---|---|---|---|
| CAS Number | 75965-78-5 | Molecular Weight | 243.21500 | |
| Density | 1.379g/cm3 | Boiling Point | 420ºC at 760 mmHg | |
| Molecular Formula | C13H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.8ºC | |
| Name | 5-methoxy-2-nitrobenzo[g][1]benzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 420ºC at 760 mmHg |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.21500 |
| Flash Point | 207.8ºC |
| Exact Mass | 243.05300 |
| PSA | 68.19000 |
| LogP | 4.02600 |
| Index of Refraction | 1.69 |
| InChIKey | YGYSUDXFOCIHEN-UHFFFAOYSA-N |
| SMILES | COc1cc2cc([N+](=O)[O-])oc2c2ccccc12 |
|
~16%
2-NITRO-5-METHO... CAS#:75965-78-5 |
| Literature: Royer; Buisson European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 275 - 278 |
|
~%
2-NITRO-5-METHO... CAS#:75965-78-5 |
| Literature: Royer; Buisson European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 275 - 278 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| nitro-2 methoxy-5 naphto<1,2-b>furanne |
| R 7202 |