Benzeneacetic acid,4-chloro-a-[(2-nitrophenyl)methylene]- structure
|
Common Name | Benzeneacetic acid,4-chloro-a-[(2-nitrophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 10465-92-6 | Molecular Weight | 303.69700 | |
| Density | 1.439g/cm3 | Boiling Point | 447ºC at 760mmHg | |
| Molecular Formula | C15H10ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.1ºC | |
| Name | 2-(4-chlorophenyl)-3-(2-nitrophenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 447ºC at 760mmHg |
| Molecular Formula | C15H10ClNO4 |
| Molecular Weight | 303.69700 |
| Flash Point | 224.1ºC |
| Exact Mass | 303.03000 |
| PSA | 83.12000 |
| LogP | 4.39660 |
| Vapour Pressure | 9E-09mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | CGQQZAUXFVBRMF-LCYFTJDESA-N |
| SMILES | O=C(O)C(=Cc1ccccc1[N+](=O)[O-])c1ccc(Cl)cc1 |
|
~43%
Benzeneacetic a... CAS#:10465-92-6 |
| Literature: Wassmundt, Frederick W.; Kiesman, William F. Journal of Organic Chemistry, 1995 , vol. 60, # 1 p. 196 - 201 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| (E)-1-chloro-4-(1-nitroprop-1-en-2-yl)benzene |
| 2-(4-chloro-phenyl)-3t-(2-nitro-phenyl)-acrylic acid |
| (E)-2-(4-chlorophenyl)-1-nitro-1-propene |
| 2-(4-Chlor-phenyl)-3t-(2-nitro-phenyl)-acrylsaeure |
| (E)-2-(4'-chlorophenyl)-1-nitropropene |
| (E)-2-(4-Chlorophenyl)-3-(2-nitrophenyl)-2-propenoic acid |
| 2-(4'-chlorophenyl)-1-nitropropene |
| Benzene,1-chloro-4-[(1E)-1-methyl-2-nitroethenyl] |
| (E)-1-nitro-2-(4-chlorophenyl)propene |