Benzeneaceticacid, a-[(2-aminophenyl)methylene]-4-chloro-
Modify Date: 2025-11-26 10:33:28
![Benzeneaceticacid, a-[(2-aminophenyl)methylene]-4-chloro- Structure](https://image.chemsrc.com/caspic/447/5443-02-7.png)
Benzeneaceticacid, a-[(2-aminophenyl)methylene]-4-chloro- structure
|
Common Name | Benzeneaceticacid, a-[(2-aminophenyl)methylene]-4-chloro- | ||
|---|---|---|---|---|
| CAS Number | 5443-02-7 | Molecular Weight | 273.71400 | |
| Density | 1.359g/cm3 | Boiling Point | 425.6ºC at 760mmHg | |
| Molecular Formula | C15H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2ºC | |
| Name | 3-(2-aminophenyl)-2-(4-chlorophenyl)prop-2-enoic acid |
|---|
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 425.6ºC at 760mmHg |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.71400 |
| Flash Point | 211.2ºC |
| Exact Mass | 273.05600 |
| PSA | 63.32000 |
| LogP | 4.12860 |
| Index of Refraction | 1.697 |
| InChIKey | NVUPTMBFVVWOLS-UKTHLTGXSA-N |
| SMILES | Nc1ccccc1C=C(C(=O)O)c1ccc(Cl)cc1 |
| HS Code | 2922499990 |
|---|
|
~%
Benzeneaceticac... CAS#:5443-02-7 |
| Literature: Nylen Chemische Berichte, 1920 , vol. 53, p. 162 |
![Benzeneacetic acid,4-chloro-a-[(2-nitrophenyl)methylene]- structure](https://image.chemsrc.com/caspic/299/10465-92-6.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |