Fluorescent Brightener 135 structure
|
Common Name | Fluorescent Brightener 135 | ||
|---|---|---|---|---|
| CAS Number | 1041-00-5 | Molecular Weight | 290.31600 | |
| Density | 1.287 | Boiling Point | 471.197ºC at 760 mmHg | |
| Molecular Formula | C18H14N2O2 | Melting Point | 180-181°C | |
| MSDS | N/A | Flash Point | 237.309ºC | |
| Name | Fluorescent Brightener 135 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287 |
|---|---|
| Boiling Point | 471.197ºC at 760 mmHg |
| Melting Point | 180-181°C |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.31600 |
| Flash Point | 237.309ºC |
| Exact Mass | 290.10600 |
| PSA | 52.06000 |
| LogP | 4.75620 |
| Vapour Pressure | 1.35E-08mmHg at 25°C |
| Index of Refraction | 1.727 |
| InChIKey | VKRZNAWSCAUDRQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc2oc(C=Cc3nc4cc(C)ccc4o3)nc2c1 |
| Hazard Codes | Xi,Xn |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . |
| Safety Phrases | S26-S36-S36/37/39-S22 |
| RIDADR | 3271.0 |
| WGK Germany | 3 |
| RTECS | RZ2475100 |
| Hazard Class | 3.0 |
|
~65%
Fluorescent Bri... CAS#:1041-00-5 |
| Literature: US2010/76040 A1, ; Page/Page column 6 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Uvitex ERN |
| 2,2'-vinylenebis[5-methylbenzoxazole] |
| 1,2-Bis(5-methylbenzoxazol-2-yl)ethene |
| 1.2 DI(5-MYTHYL-BENZIAZOLYL)ETHYLENE |
| 1,2-bis(5-methylbenzoxazol-2-yl)ethylene |
| EINECS 213-866-1 |
| 1,2-Bis(5-methyl-2-benzoxazole)ethylene |
| Benzoxazole,2,2'-(1,2-ethenediyl)bis[5-methyl |
| C.I.Fluorescent brightening agent 135 |
| Flourescent bleaches DT |
| Fluorescent Whitener DT |