UNII:3B92G18V2B structure
|
Common Name | UNII:3B92G18V2B | ||
|---|---|---|---|---|
| CAS Number | 10399-13-0 | Molecular Weight | 248.318 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 375.4±22.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O3 | Melting Point | 118-120 °C(lit.) | |
| MSDS | N/A | Flash Point | 154.0±15.1 °C | |
| Name | Methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.4±22.0 °C at 760 mmHg |
| Melting Point | 118-120 °C(lit.) |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.318 |
| Flash Point | 154.0±15.1 °C |
| Exact Mass | 248.141251 |
| PSA | 46.53000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | SPTZOODMHSABLY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918199090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl 2-Cyclohexyl-2-hydroxyphenylacetate |
| Cyclohexyl 2-hydroxy-2-phenylpropanoate |
| EINECS 233-862-3 |
| Benzeneacetic acid, α-hydroxy-α-methyl-, cyclohexyl ester |
| MFCD00269807 |
| Methyl cyclohexylphenylglycolate |
| Benzeneacetic acid, α-cyclohexyl-α-hydroxy-, methyl ester |
| UNII:3B92G18V2B |
| Methyl cyclohexyl(hydroxy)phenylacetate |