2-Bromo-4'-(trifluoromethoxy)acetophenone structure
|
Common Name | 2-Bromo-4'-(trifluoromethoxy)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 103962-10-3 | Molecular Weight | 283.042 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 266.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H6BrF3O2 | Melting Point | 55 °C | |
| MSDS | Chinese USA | Flash Point | 114.7±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(Trifluoromethoxy)Phenacyl Bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 266.0±35.0 °C at 760 mmHg |
| Melting Point | 55 °C |
| Molecular Formula | C9H6BrF3O2 |
| Molecular Weight | 283.042 |
| Flash Point | 114.7±25.9 °C |
| Exact Mass | 281.950317 |
| PSA | 26.30000 |
| LogP | 3.30 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | AOAGGWLQIILIIV-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc(OC(F)(F)F)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | C: Corrosive;Xi: Irritant; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 1759 |
| HS Code | 2914700090 |
|
~56%
2-Bromo-4'-(tri... CAS#:103962-10-3 |
| Literature: DR.REDDY'S LABORATORIES LTD.; SASMAL, Pradip Kumar; VAMSEEKRISHNA, Chintakunta; POTLURI, Vijay; TEHIM, Ashok; GAI, Yonghua; ZHANG, Hang Patent: WO2013/131408 A1, 2013 ; Location in patent: Page/Page column 128 ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Bromo-4-Trifluoromethoxyacetophenoen |
| 2-Bromo-1-[4-(trifluoromethoxy)phenyl]ethan-1-one |
| 2-Bromo-1-(4-(trifluoromethoxy)phenyl)ethanone |
| Ethanone, 2-bromo-1-[4-(trifluoromethoxy)phenyl]- |
| 2-Bromo-1-[4-(trifluoromethoxy)phenyl]ethanone |
| MFCD00052333 |
| 2-Bromo-4'-(trifluoromethoxy)acetophenone |