2-(4-Bromophenyl)-4-quinolinecarboxylic acid structure
|
Common Name | 2-(4-Bromophenyl)-4-quinolinecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 103914-52-9 | Molecular Weight | 328.160 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 497.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C16H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8±27.3 °C | |
| Name | 2-(4-Bromophenyl)quinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 497.7±40.0 °C at 760 mmHg |
| Molecular Formula | C16H10BrNO2 |
| Molecular Weight | 328.160 |
| Flash Point | 254.8±27.3 °C |
| Exact Mass | 326.989471 |
| PSA | 50.19000 |
| LogP | 4.90 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | JEUYPXDMAWIMOG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccc(Br)cc2)nc2ccccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933499090 |
|
~94%
2-(4-Bromopheny... CAS#:103914-52-9 |
| Literature: Nicolaie, E; Guengoer, T; Goyard, J; Cure, G; Fouquet, A; et al. European Journal of Medicinal Chemistry, 1992 , vol. 27, # 9 p. 977 - 984 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00160560 |
| 2-(4-Bromophenyl)-4-quinolinecarboxylic acid |
| 4-Quinolinecarboxylic acid, 2-(4-bromophenyl)- |
| 2-(4-Bromophenyl)quinoline-4-carboxylic acid |