Rho-Kinase-IN-1
Modify Date: 2025-08-27 10:16:39
Rho-Kinase-IN-1 structure
|
Common Name | Rho-Kinase-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1035094-83-7 | Molecular Weight | 352.496 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 567.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H24N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.7±30.1 °C | |
Use of Rho-Kinase-IN-1Rho-Kinase-IN-1 is a rho kinase inhibitor extracted from US 20090325960 A1, compound 1.008. |
| Name | Rho-Kinase-IN-1 |
|---|---|
| Synonym | More Synonyms |
| Description | Rho-Kinase-IN-1 is a rho kinase inhibitor extracted from US 20090325960 A1, compound 1.008. |
|---|---|
| Related Catalog | |
| Target |
Rho kinase[1] |
| In Vitro | Rho-Kinase-IN-1 is a rho kinaseinhibitor which can be useful for treating diseases or conditions associated with excessive cell proliferation, remodeling, edema and inflammation[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 567.0±50.0 °C at 760 mmHg |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.496 |
| Flash Point | 296.7±30.1 °C |
| Exact Mass | 352.172180 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | DPZSYTMLVCLGRU-UHFFFAOYSA-N |
| SMILES | CSc1ccc(CN2CCCC(Nc3ccc4[nH]ncc4c3)C2)cc1 |
| Storage condition | 2-8℃ |
| 1H-Indazol-5-amine, N-[1-[[4-(methylthio)phenyl]methyl]-3-piperidinyl]- |
| N-{1-[4-(Methylsulfanyl)benzyl]-3-piperidinyl}-1H-indazol-5-amine |