bis(3-methylbutyl) sebacate structure
|
Common Name | bis(3-methylbutyl) sebacate | ||
|---|---|---|---|---|
| CAS Number | 10340-42-8 | Molecular Weight | 342.51300 | |
| Density | 0.934g/cm3 | Boiling Point | 358.9ºC at 760mmHg | |
| Molecular Formula | C20H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | bis(3-methylbutyl) decanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.934g/cm3 |
|---|---|
| Boiling Point | 358.9ºC at 760mmHg |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.51300 |
| Flash Point | 158ºC |
| Exact Mass | 342.27700 |
| PSA | 52.60000 |
| LogP | 5.28580 |
| Vapour Pressure | 2.46E-05mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | AZTORLUDPYUCLK-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=O)CCCCCCCCC(=O)OCCC(C)C |
| HS Code | 2917131000 |
|---|
|
~%
bis(3-methylbut... CAS#:10340-42-8 |
| Literature: Iwakura Kobunshi Kagaku, 1945 , vol. 2, p. 287,296 Chem.Abstr., 1950 , p. 5144 |
|
~%
bis(3-methylbut... CAS#:10340-42-8 |
| Literature: Neison Journal of the Chemical Society, 1876 , vol. 29, p. 315 Jahresbericht ueber die Fortschritte der Chemie und Verwandter Theile Anderer Wissenschaften, 1876 , p. 576 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917131000 |
|---|---|
| Summary | 2917131000 esters of adipic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| decanedioic acid diisopentyl ester |
| EINECS 233-736-8 |
| Bis(3-methylbutyl) sebacate |
| Decandisaeure-diisopentylester |
| Decanedioic acid,1,10-bis(3-methylbutyl) ester |