(+)-3,9-dibromocamphor structure
|
Common Name | (+)-3,9-dibromocamphor | ||
|---|---|---|---|---|
| CAS Number | 10293-10-4 | Molecular Weight | 310.02600 | |
| Density | 1.689g/cm3 | Boiling Point | 314.5ºC at 760mmHg | |
| Molecular Formula | C10H14Br2O | Melting Point | 156-159ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 89.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-bromo-7-(bromomethyl)-4,7-dimethylbicyclo[2.2.1]heptan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.689g/cm3 |
|---|---|
| Boiling Point | 314.5ºC at 760mmHg |
| Melting Point | 156-159ºC(lit.) |
| Molecular Formula | C10H14Br2O |
| Molecular Weight | 310.02600 |
| Flash Point | 89.1ºC |
| Exact Mass | 307.94100 |
| PSA | 17.07000 |
| LogP | 3.15010 |
| Vapour Pressure | 0.000464mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | DCDNKSJBRIJYEC-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(Br)C1=O)C2(C)CBr |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
|
~%
(+)-3,9-dibromo... CAS#:10293-10-4 |
| Literature: Proceedings of the Japan Academy, , vol. 27, p. 285 |
|
~%
(+)-3,9-dibromo... CAS#:10293-10-4 |
| Literature: Canadian Journal of Chemistry, , vol. 61, p. 343 - 346 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| (+)-endo-3,9-dibromocamphor |
| (+)-3,9-DibroMocaMphor |
| 3-endo-,9-dibromocamphor |
| 3,9-Dibromo-(+)-camphor |
| MFCD00167983 |
| 3-endo-9-dibromo-1,7,7-trimethylbicyclo<2.2.1>heptan-2-one |