2-nitro-4-pyridinol
Modify Date: 2025-08-26 18:05:27
2-nitro-4-pyridinol structure
|
Common Name | 2-nitro-4-pyridinol | ||
|---|---|---|---|---|
| CAS Number | 101654-28-8 | Molecular Weight | 140.09700 | |
| Density | 1.44g/cm3 | Boiling Point | 255.1ºC at 760mmHg | |
| Molecular Formula | C5H4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.1ºC | |
| Name | 2-nitro-1H-pyridin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 255.1ºC at 760mmHg |
| Molecular Formula | C5H4N2O3 |
| Molecular Weight | 140.09700 |
| Flash Point | 108.1ºC |
| Exact Mass | 140.02200 |
| PSA | 78.94000 |
| LogP | 1.21860 |
| Vapour Pressure | 0.0166mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | NJTUZNXKDOUPHP-UHFFFAOYSA-N |
| SMILES | O=c1cc[nH]c([N+](=O)[O-])c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:6320-39-4| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Nitro-4-pyridinol |
| 4-Pyridinol,2-nitro |
| 4-HYDROXY-2-NITROPYRIDINE |
| 2-Nitropyridin-4-ol |
| 2-Nitro-4-hydroxy-pyridin |