2-Nitro-4-(trifluoromethoxy)phenol structure
|
Common Name | 2-Nitro-4-(trifluoromethoxy)phenol | ||
|---|---|---|---|---|
| CAS Number | 129644-56-0 | Molecular Weight | 223.10600 | |
| Density | 1.592g/cm3 | Boiling Point | 240.3ºC at 760 mmHg | |
| Molecular Formula | C7H4F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.1ºC | |
| Name | 2-Nitro-4-(trifluoromethoxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.592g/cm3 |
|---|---|
| Boiling Point | 240.3ºC at 760 mmHg |
| Molecular Formula | C7H4F3NO4 |
| Molecular Weight | 223.10600 |
| Flash Point | 99.1ºC |
| Exact Mass | 223.00900 |
| PSA | 75.28000 |
| LogP | 2.72220 |
| Vapour Pressure | 0.0247mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | FNQAEUBXLFDRKW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(OC(F)(F)F)ccc1O |
| HS Code | 2909500000 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Nitro-4-trifluoromethoxyphenol |
| Nitro-4-(trifluoromethoxy)phenol |
| PC2782 |
| 4-trifluoromethoxy-2-nitrophenol |
| Phenol,2-nitro-4-(trifluoromethoxy) |