4'-Acetamido-3'-bromoacetophenone
Modify Date: 2025-09-18 14:50:30
4'-Acetamido-3'-bromoacetophenone structure
|
Common Name | 4'-Acetamido-3'-bromoacetophenone | ||
|---|---|---|---|---|
| CAS Number | 101209-08-9 | Molecular Weight | 256.09600 | |
| Density | 1.504g/cm3 | Boiling Point | 436.1ºC at 760mmHg | |
| Molecular Formula | C10H10BrNO2 | Melting Point | 139-143ºC | |
| MSDS | Chinese USA | Flash Point | 217.5ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 4-Acetamido-3-bromoacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.504g/cm3 |
|---|---|
| Boiling Point | 436.1ºC at 760mmHg |
| Melting Point | 139-143ºC |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.09600 |
| Flash Point | 217.5ºC |
| Exact Mass | 254.98900 |
| PSA | 46.17000 |
| LogP | 2.68310 |
| Vapour Pressure | 8.32E-08mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | PMYJAVHDFDKJBS-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(C)=O)cc1Br |
|
~%
4'-Acetamido-3'... CAS#:101209-08-9 |
| Literature: Journal of the American Chemical Society, , vol. 50, p. 160 |
|
~%
4'-Acetamido-3'... CAS#:101209-08-9 |
| Literature: Journal of the American Chemical Society, , vol. 50, p. 160 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-acetyl-2-bromophenyl)acetamide |
| MFCD00051781 |