4,8-dihydroxyquinoline
Modify Date: 2025-08-25 13:18:28
4,8-dihydroxyquinoline structure
|
Common Name | 4,8-dihydroxyquinoline | ||
|---|---|---|---|---|
| CAS Number | 10118-81-7 | Molecular Weight | 182.13000 | |
| Density | 1.619g/cm3 | Boiling Point | 445.4ºC at 760 mmHg | |
| Molecular Formula | C8H6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.3ºC | |
| Name | 4,8-dihydroxyquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.619g/cm3 |
|---|---|
| Boiling Point | 445.4ºC at 760 mmHg |
| Molecular Formula | C8H6O5 |
| Molecular Weight | 182.13000 |
| Flash Point | 237.3ºC |
| Exact Mass | 182.02200 |
| PSA | 94.83000 |
| LogP | 0.36510 |
| Vapour Pressure | 1.02E-08mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | HNZXTILLSIEXRZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)c1ccc(O)c(O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
CAS#:861377-46-0
CAS#:99-50-3
CAS#:86787-79-3
CAS#:89662-01-1| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3.4-Dioxy-phenyl-glyoxylsaeure |
| Protocatechuylameisensaeure |
| 3,4-Dihydroxyphenylglyoxim |
| 3,4-Dihydroxyphenylglyoxime |
| 3.4-Dioxy-benzoyl-ameisensaeure |