Ethyl 4,8-dihydroxy-3-quinolinecarboxylate structure
|
Common Name | Ethyl 4,8-dihydroxy-3-quinolinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 27333-37-5 | Molecular Weight | 233.220 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 396.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4±26.5 °C | |
| Name | ethyl 8-hydroxy-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 396.1±37.0 °C at 760 mmHg |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.220 |
| Flash Point | 193.4±26.5 °C |
| Exact Mass | 233.068802 |
| PSA | 79.39000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | DJGXPLQGGHSMGV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c[nH]c2c(O)cccc2c1=O |
| HS Code | 2933499090 |
|---|
|
~%
Ethyl 4,8-dihyd... CAS#:27333-37-5 |
| Literature: Pharmacia and Upjohn Company LLC Patent: EP1042295 B1, 2005 ; Location in patent: Page/Page column 57 ; |
|
~%
Ethyl 4,8-dihyd... CAS#:27333-37-5 |
| Literature: Pharmacia and Upjohn Company Patent: US6093732 A1, 2000 ; |
|
~%
Ethyl 4,8-dihyd... CAS#:27333-37-5 |
| Literature: Sardesai; Sunthankar Journal of Scientific and Industrial Research, 1959 , vol. 18 B, p. 158,161 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,8-Dihydroxy-chinolin-3-carbonsaeure-aethylester |
| Ethyl 4,8-dihydroxyquinoline-3-carboxylate |
| Ethyl 4,8-dihydroxy-3-quinolinecarboxylate |
| 4,8-Dihydroxyquinoline-3-carboxylic acid ethyl ester |
| 3-Quinolinecarboxylic acid, 4,8-dihydroxy-, ethyl ester |