N,N,N-Trimethyl-1-decanaminium chloride structure
|
Common Name | N,N,N-Trimethyl-1-decanaminium chloride | ||
|---|---|---|---|---|
| CAS Number | 10108-87-9 | Molecular Weight | 235.837 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H30ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N,N,N-Trimethyl-1-decanaminium chlorideN,N,N-Trimethyldecan-1-aminium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Decyltrimethylammonium chloride |
|---|---|
| Synonym | More Synonyms |
| Description | N,N,N-Trimethyldecan-1-aminium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Molecular Formula | C13H30ClN |
|---|---|
| Molecular Weight | 235.837 |
| Exact Mass | 235.206680 |
| LogP | 0.83730 |
| InChIKey | HXWGXXDEYMNGCT-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[N+](C)(C)C.[Cl-] |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2923900090 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N,N,N-Trimethyl-1-decanaminium chloride |
| N,N,N-Trimethyldecan-1-aminium chloride |
| decyl(trimethyl)azanium,chloride |
| 1-Decanaminium, N,N,N-trimethyl-, chloride (1:1) |
| Decyltrimethylammonium Chloride |
| EINECS 233-299-3 |
| MFCD00059967 |