3-(3,4-Dichlorophenyl)-1,1-bis[(2H3)methyl]urea structure
|
Common Name | 3-(3,4-Dichlorophenyl)-1,1-bis[(2H3)methyl]urea | ||
|---|---|---|---|---|
| CAS Number | 1007536-67-5 | Molecular Weight | 239.13 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 385.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H4D6Cl2N2O | Melting Point | 147-150?C | |
| MSDS | USA | Flash Point | 186.7±27.9 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
Use of 3-(3,4-Dichlorophenyl)-1,1-bis[(2H3)methyl]ureaDiuron-d6 is the deuterium labeled Adamantane[1]. |
| Name | 3-(3,4-dichlorophenyl)-1,1-bis(trideuteriomethyl)urea |
|---|---|
| Synonym | More Synonyms |
| Description | Diuron-d6 is the deuterium labeled Adamantane[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[75]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 385.2±42.0 °C at 760 mmHg |
| Melting Point | 147-150?C |
| Molecular Formula | C9H4D6Cl2N2O |
| Molecular Weight | 239.13 |
| Flash Point | 186.7±27.9 °C |
| Exact Mass | 238.054672 |
| PSA | 35.83000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | XMTQQYYKAHVGBJ-WFGJKAKNSA-N |
| SMILES | CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| Storage condition | Refrigerator |
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H351-H373-H410 |
| Precautionary Statements | P260-P280-P301 + P312 + P330 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,N |
| Risk Phrases | 22-40-48/22-50/53 |
| Safety Phrases | 13-22-23-37-46-60-61-36/37 |
| RIDADR | UN 3077 9/PG 3 |
|
Polar organic chemical integrative samplers for pesticides monitoring: impacts of field exposure conditions.
Sci. Total Environ. 488-489 , 188-96, (2014) This study focuses on how Polar Organic Chemical Integrative Samplers (POCIS) work in real environmental conditions. A selection of 23 polar pesticides and 8 metabolites were investigated by exposure ... |
| Urea, N'-(3,4-dichlorophenyl)-N,N-dimethyl-d- |
| 3-(3,4-Dichlorophenyl)-1,1-dimethylurea-d6 |
| Diuron-d6 |
| 3-(3,4-Dichlorophenyl)-1,1-bis[(H)methyl]urea |